C31H35NO6 — CID 67933189
ethyl 2-[4-[(2R)-2-[[2-(2-benzofuran-1-yl)-2-hydroxyethyl]-[(1R)-1-hydroxy-2-phenylethyl]amino]propyl]phenoxy]acetate (PubChem CID 67933189) has the molecular formula C31H35NO6 and a molecular weight of 517.62 g/mol. Its IUPAC name is ethyl 2-[4-[(2R)-2-[[2-(2-benzofuran-1-yl)-2-hydroxyethyl]-[(1R)-1-hydroxy-2-phenylethyl]amino]propyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[(2R)-2-[[2-(2-benzofuran-1-yl)-2-hydroxyethyl]-[(1R)-1-hydroxy-2-phenylethyl]amino]propyl]phenoxy]acetate |
|---|---|
| PubChem CID | 67933189 |
| Molecular Formula | C31H35NO6 |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | ethyl 2-[4-[(2R)-2-[[2-(2-benzofuran-1-yl)-2-hydroxyethyl]-[(1R)-1-hydroxy-2-phenylethyl]amino]propyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C[C@@H](C)N(CC(O)c2occ3ccccc23)[C@H](O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C31H35NO6/c1-3-36-30(35)21-37-26-15-13-24(14-16-26)17-22(2)32(29(34)18-23-9-5-4-6-10-23)19-28(33)31-27-12-8-7-11-25(27)20-38-31/h4-16,20,22,28-29,33-34H,3,17-19,21H2,1-2H3/t22-,28?,29-/m1/s1 |
| InChIKey | ZGBSHMFGEICKHI-SLMGNQKFSA-N |
| XLogP | 4.90 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|