C8H16N3O3- — CID 88519589
tert-butyl N-(1-oxidoimidazolidin-4-yl)carbamate (PubChem CID 88519589) has the molecular formula C8H16N3O3- and a molecular weight of 202.23 g/mol. Its IUPAC name is tert-butyl N-(1-oxidoimidazolidin-4-yl)carbamate.
| Compound Name | tert-butyl N-(1-oxidoimidazolidin-4-yl)carbamate |
|---|---|
| PubChem CID | 88519589 |
| Molecular Formula | C8H16N3O3- |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | tert-butyl N-(1-oxidoimidazolidin-4-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CN([O-])CN1 |
| InChI | InChI=1S/C8H16N3O3/c1-8(2,3)14-7(12)10-6-4-11(13)5-9-6/h6,9H,4-5H2,1-3H3,(H,10,12)/q-1 |
| InChIKey | LOAJWOSXVWFRBC-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |