C6H10O4S — CID 88519629
1-hydroxy-3,3-dimethyl-1-sulfonylbutan-2-one (PubChem CID 88519629) has the molecular formula C6H10O4S and a molecular weight of 178.21 g/mol. Its IUPAC name is 1-hydroxy-3,3-dimethyl-1-sulfonylbutan-2-one.
| Compound Name | 1-hydroxy-3,3-dimethyl-1-sulfonylbutan-2-one |
|---|---|
| PubChem CID | 88519629 |
| Molecular Formula | C6H10O4S |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | 1-hydroxy-3,3-dimethyl-1-sulfonylbutan-2-one |
| SMILES | CC(C)(C)C(=O)C(O)=S(=O)=O |
| InChI | InChI=1S/C6H10O4S/c1-6(2,3)4(7)5(8)11(9)10/h8H,1-3H3 |
| InChIKey | DPYRBZNGIWOHMX-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|