About 1-hydroxy-3,3-dimethyl-1-sulfonylbutan-2-one
1-hydroxy-3,3-dimethyl-1-sulfonylbutan-2-one (PubChem CID 88519629) has the molecular formula C6H10O4S
and a molecular weight of 178.21 g/mol. Its IUPAC name is 1-hydroxy-3,3-dimethyl-1-sulfonylbutan-2-one.
Molecular Properties
| Compound Name | 1-hydroxy-3,3-dimethyl-1-sulfonylbutan-2-one |
| PubChem CID | 88519629 |
| Molecular Formula | C6H10O4S |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | 1-hydroxy-3,3-dimethyl-1-sulfonylbutan-2-one |
| SMILES | CC(C)(C)C(=O)C(O)=S(=O)=O |
| InChI | InChI=1S/C6H10O4S/c1-6(2,3)4(7)5(8)11(9)10/h8H,1-3H3 |
| InChIKey | DPYRBZNGIWOHMX-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-3,3-dimethyl-1-sulfonylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-3,3-dimethyl-1-sulfonylbutan-2-one?
The IUPAC name of 1-hydroxy-3,3-dimethyl-1-sulfonylbutan-2-one (CID 88519629) is 1-hydroxy-3,3-dimethyl-1-sulfonylbutan-2-one.
What is the SMILES notation for 1-hydroxy-3,3-dimethyl-1-sulfonylbutan-2-one?
The canonical SMILES for 1-hydroxy-3,3-dimethyl-1-sulfonylbutan-2-one is CC(C)(C)C(=O)C(O)=S(=O)=O.
What is the InChIKey of 1-hydroxy-3,3-dimethyl-1-sulfonylbutan-2-one?
The InChIKey is DPYRBZNGIWOHMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4S/c1-6(2,3)4(7)5(8)11(9)10/h8H,1-3H3.
What are the key properties of 1-hydroxy-3,3-dimethyl-1-sulfonylbutan-2-one?
1-hydroxy-3,3-dimethyl-1-sulfonylbutan-2-one has a molecular weight of 178.21 g/mol, XLogP of 0.17, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-3,3-dimethyl-1-sulfonylbutan-2-one is sourced from PubChem (CID 88519629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).