C29H36N4O3S — CID 88519981
3-[(1S,2R,3E,5Z)-1-hydroxy-13-phenyl-1-[3-(2H-tetrazol-5-yl)phenyl]trideca-3,5-dien-2-yl]sulfanylpropanoic acid (PubChem CID 88519981) has the molecular formula C29H36N4O3S and a molecular weight of 520.70 g/mol. Its IUPAC name is 3-[(1S,2R,3E,5Z)-1-hydroxy-13-phenyl-1-[3-(2H-tetrazol-5-yl)phenyl]trideca-3,5-dien-2-yl]sulfanylpropanoic acid.
| Compound Name | 3-[(1S,2R,3E,5Z)-1-hydroxy-13-phenyl-1-[3-(2H-tetrazol-5-yl)phenyl]trideca-3,5-dien-2-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 88519981 |
| Molecular Formula | C29H36N4O3S |
| Molecular Weight | 520.70 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | 3-[(1S,2R,3E,5Z)-1-hydroxy-13-phenyl-1-[3-(2H-tetrazol-5-yl)phenyl]trideca-3,5-dien-2-yl]sulfanylpropanoic acid |
| SMILES | O=C(O)CCS[C@H](/C=C/C=C\CCCCCCCc1ccccc1)[C@@H](O)c1cccc(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C29H36N4O3S/c34-27(35)20-21-37-26(28(36)24-17-13-18-25(22-24)29-30-32-33-31-29)19-12-7-5-3-1-2-4-6-9-14-23-15-10-8-11-16-23/h5,7-8,10-13,15-19,22,26,28,36H,1-4,6,9,14,20-21H2,(H,34,35)(H,30,31,32,33)/b7-5-,19-12+/t26-,28+/m1/s1 |
| InChIKey | LXHMZLHDBPPUTH-UIUYDODCSA-N |
| XLogP | 6.17 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.70 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|