C23H34N4O3S2 — CID 19837393
3-[(3E,5E)-1-hydroxy-1-[5-(2H-tetrazol-5-yl)thiophen-2-yl]pentadeca-3,5-dien-2-yl]sulfanylpropanoic acid (PubChem CID 19837393) has the molecular formula C23H34N4O3S2 and a molecular weight of 478.68 g/mol. Its IUPAC name is 3-[(3E,5E)-1-hydroxy-1-[5-(2H-tetrazol-5-yl)thiophen-2-yl]pentadeca-3,5-dien-2-yl]sulfanylpropanoic acid.
| Compound Name | 3-[(3E,5E)-1-hydroxy-1-[5-(2H-tetrazol-5-yl)thiophen-2-yl]pentadeca-3,5-dien-2-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 19837393 |
| Molecular Formula | C23H34N4O3S2 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 3-[(3E,5E)-1-hydroxy-1-[5-(2H-tetrazol-5-yl)thiophen-2-yl]pentadeca-3,5-dien-2-yl]sulfanylpropanoic acid |
| SMILES | CCCCCCCCC/C=C/C=C/C(SCCC(=O)O)C(O)c1ccc(-c2nn[nH]n2)s1 |
| InChI | InChI=1S/C23H34N4O3S2/c1-2-3-4-5-6-7-8-9-10-11-12-13-18(31-17-16-21(28)29)22(30)19-14-15-20(32-19)23-24-26-27-25-23/h10-15,18,22,30H,2-9,16-17H2,1H3,(H,28,29)(H,24,25,26,27)/b11-10+,13-12+ |
| InChIKey | IGAQBWAKFMVWNP-AQASXUMVSA-N |
| XLogP | 5.79 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|