C23H33NO3S2 — CID 88521534
3-[(1S,2R,3E,5Z)-1-(5-cyanothiophen-2-yl)-1-hydroxypentadeca-3,5-dien-2-yl]sulfanylpropanoic acid (PubChem CID 88521534) has the molecular formula C23H33NO3S2 and a molecular weight of 435.66 g/mol. Its IUPAC name is 3-[(1S,2R,3E,5Z)-1-(5-cyanothiophen-2-yl)-1-hydroxypentadeca-3,5-dien-2-yl]sulfanylpropanoic acid.
| Compound Name | 3-[(1S,2R,3E,5Z)-1-(5-cyanothiophen-2-yl)-1-hydroxypentadeca-3,5-dien-2-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 88521534 |
| Molecular Formula | C23H33NO3S2 |
| Molecular Weight | 435.66 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 3-[(1S,2R,3E,5Z)-1-(5-cyanothiophen-2-yl)-1-hydroxypentadeca-3,5-dien-2-yl]sulfanylpropanoic acid |
| SMILES | CCCCCCCCC/C=C\C=C\[C@@H](SCCC(=O)O)[C@H](O)c1ccc(C#N)s1 |
| InChI | InChI=1S/C23H33NO3S2/c1-2-3-4-5-6-7-8-9-10-11-12-13-20(28-17-16-22(25)26)23(27)21-15-14-19(18-24)29-21/h10-15,20,23,27H,2-9,16-17H2,1H3,(H,25,26)/b11-10-,13-12+/t20-,23+/m1/s1 |
| InChIKey | HJXAMZVVMNSFBD-FPHVWGNHSA-N |
| XLogP | 6.48 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.66 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|