C20H42N2O5S — CID 88520070
3-(4,5-dihydro-1H-imidazol-3-ium-3-yl)pentadecan-2-ol;ethyl sulfate (PubChem CID 88520070) has the molecular formula C20H42N2O5S and a molecular weight of 422.63 g/mol. Its IUPAC name is 3-(4,5-dihydro-1H-imidazol-3-ium-3-yl)pentadecan-2-ol;ethyl sulfate.
| Compound Name | 3-(4,5-dihydro-1H-imidazol-3-ium-3-yl)pentadecan-2-ol;ethyl sulfate |
|---|---|
| PubChem CID | 88520070 |
| Molecular Formula | C20H42N2O5S |
| Molecular Weight | 422.63 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | 3-(4,5-dihydro-1H-imidazol-3-ium-3-yl)pentadecan-2-ol;ethyl sulfate |
| SMILES | CCCCCCCCCCCCC(C(C)O)[N+]1=CNCC1.CCOS(=O)(=O)[O-] |
| InChI | InChI=1S/C18H36N2O.C2H6O4S/c1-3-4-5-6-7-8-9-10-11-12-13-18(17(2)21)20-15-14-19-16-20;1-2-6-7(3,4)5/h16-18,21H,3-15H2,1-2H3;2H2,1H3,(H,3,4,5) |
| InChIKey | OPUIONPBUUYIKX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.63 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|