C20H44N2O5S — CID 88520074
ethyl sulfate;1-(3-ethyl-2-undecylimidazolidin-1-ium-1-yl)ethanol (PubChem CID 88520074) has the molecular formula C20H44N2O5S and a molecular weight of 424.65 g/mol. Its IUPAC name is ethyl sulfate;1-(3-ethyl-2-undecylimidazolidin-1-ium-1-yl)ethanol.
| Compound Name | ethyl sulfate;1-(3-ethyl-2-undecylimidazolidin-1-ium-1-yl)ethanol |
|---|---|
| PubChem CID | 88520074 |
| Molecular Formula | C20H44N2O5S |
| Molecular Weight | 424.65 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | ethyl sulfate;1-(3-ethyl-2-undecylimidazolidin-1-ium-1-yl)ethanol |
| SMILES | CCCCCCCCCCCC1N(CC)CC[NH+]1C(C)O.CCOS(=O)(=O)[O-] |
| InChI | InChI=1S/C18H38N2O.C2H6O4S/c1-4-6-7-8-9-10-11-12-13-14-18-19(5-2)15-16-20(18)17(3)21;1-2-6-7(3,4)5/h17-18,21H,4-16H2,1-3H3;2H2,1H3,(H,3,4,5) |
| InChIKey | DXXKSCBJKCXRMW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 94.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.65 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|