C41H49FO6Si — CID 88522855
[4-[(E)-2-[(2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-6-oxooxan-2-yl]ethenyl]-3-(4-fluoro-3-methylphenyl)-5,5-dimethylcyclohex-3-en-1-yl] propaneperoxoate (PubChem CID 88522855) has the molecular formula C41H49FO6Si and a molecular weight of 684.92 g/mol. Its IUPAC name is [4-[(E)-2-[(2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-6-oxooxan-2-yl]ethenyl]-3-(4-fluoro-3-methylphenyl)-5,5-dimethylcyclohex-3-en-1-yl] propaneperoxoate.
| Compound Name | [4-[(E)-2-[(2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-6-oxooxan-2-yl]ethenyl]-3-(4-fluoro-3-methylphenyl)-5,5-dimethylcyclohex-3-en-1-yl] propaneperoxoate |
|---|---|
| PubChem CID | 88522855 |
| Molecular Formula | C41H49FO6Si |
| Molecular Weight | 684.92 g/mol |
| Exact Mass | 684.33 |
| IUPAC Name | [4-[(E)-2-[(2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-6-oxooxan-2-yl]ethenyl]-3-(4-fluoro-3-methylphenyl)-5,5-dimethylcyclohex-3-en-1-yl] propaneperoxoate |
| SMILES | CCC(=O)OOC1CC(c2ccc(F)c(C)c2)=C(/C=C/[C@@H]2C[C@@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CC(=O)O2)C(C)(C)C1 |
| InChI | InChI=1S/C41H49FO6Si/c1-8-38(43)47-46-32-25-35(29-19-22-37(42)28(2)23-29)36(41(6,7)27-32)21-20-30-24-31(26-39(44)45-30)48-49(40(3,4)5,33-15-11-9-12-16-33)34-17-13-10-14-18-34/h9-23,30-32H,8,24-27H2,1-7H3/b21-20+/t30-,31-,32?/m1/s1 |
| InChIKey | WAMJUVTZGOHLIU-QRWBKNFPSA-N |
| XLogP | 8.17 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.92 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|