C52H90N2O9 — CID 88524759
2,2-bis(1,2,2,6,6-pentamethylpiperidin-1-ium-1-yl)decanedioate;2-[1-(3,5-ditert-butyl-4-hydroxyphenyl)pentyl]propanedioic acid (PubChem CID 88524759) has the molecular formula C52H90N2O9 and a molecular weight of 887.30 g/mol. Its IUPAC name is 2,2-bis(1,2,2,6,6-pentamethylpiperidin-1-ium-1-yl)decanedioate;2-[1-(3,5-ditert-butyl-4-hydroxyphenyl)pentyl]propanedioic acid.
| Compound Name | 2,2-bis(1,2,2,6,6-pentamethylpiperidin-1-ium-1-yl)decanedioate;2-[1-(3,5-ditert-butyl-4-hydroxyphenyl)pentyl]propanedioic acid |
|---|---|
| PubChem CID | 88524759 |
| Molecular Formula | C52H90N2O9 |
| Molecular Weight | 887.30 g/mol |
| Exact Mass | 886.66 |
| IUPAC Name | 2,2-bis(1,2,2,6,6-pentamethylpiperidin-1-ium-1-yl)decanedioate;2-[1-(3,5-ditert-butyl-4-hydroxyphenyl)pentyl]propanedioic acid |
| SMILES | CC1(C)CCCC(C)(C)[N+]1(C)C(CCCCCCCC(=O)[O-])(C(=O)[O-])[N+]1(C)C(C)(C)CCCC1(C)C.CCCCC(c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C(C(=O)O)C(=O)O |
| InChI | InChI=1S/C30H56N2O4.C22H34O5/c1-26(2)19-16-20-27(3,4)31(26,9)30(25(35)36,23-15-13-11-12-14-18-24(33)34)32(10)28(5,6)21-17-22-29(32,7)8;1-8-9-10-14(17(19(24)25)20(26)27)13-11-15(21(2,3)4)18(23)16(12-13)22(5,6)7/h11-23H2,1-10H3;11-12,14,17,23H,8-10H2,1-7H3,(H,24,25)(H,26,27) |
| InChIKey | VYHJDDKPWDWVIR-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 175.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.30 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|