C32H30N2O10P2 — CID 88525546
1-N,3-N-bis[bis(phenylperoxy)phosphorylmethyl]benzene-1,3-diamine (PubChem CID 88525546) has the molecular formula C32H30N2O10P2 and a molecular weight of 664.54 g/mol. Its IUPAC name is 1-N,3-N-bis[bis(phenylperoxy)phosphorylmethyl]benzene-1,3-diamine.
| Compound Name | 1-N,3-N-bis[bis(phenylperoxy)phosphorylmethyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 88525546 |
| Molecular Formula | C32H30N2O10P2 |
| Molecular Weight | 664.54 g/mol |
| Exact Mass | 664.14 |
| IUPAC Name | 1-N,3-N-bis[bis(phenylperoxy)phosphorylmethyl]benzene-1,3-diamine |
| SMILES | O=P(CNc1cccc(NCP(=O)(OOc2ccccc2)OOc2ccccc2)c1)(OOc1ccccc1)OOc1ccccc1 |
| InChI | InChI=1S/C32H30N2O10P2/c35-45(41-37-29-16-5-1-6-17-29,42-38-30-18-7-2-8-19-30)25-33-27-14-13-15-28(24-27)34-26-46(36,43-39-31-20-9-3-10-21-31)44-40-32-22-11-4-12-23-32/h1-24,33-34H,25-26H2 |
| InChIKey | ZFKWPLCPKLFIKQ-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 132.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.54 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|