C11H14O8S — CID 88528450
acetic acid;(2-formyl-5-methoxyphenyl)methyl hydrogen sulfate (PubChem CID 88528450) has the molecular formula C11H14O8S and a molecular weight of 306.29 g/mol. Its IUPAC name is acetic acid;(2-formyl-5-methoxyphenyl)methyl hydrogen sulfate.
| Compound Name | acetic acid;(2-formyl-5-methoxyphenyl)methyl hydrogen sulfate |
|---|---|
| PubChem CID | 88528450 |
| Molecular Formula | C11H14O8S |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | acetic acid;(2-formyl-5-methoxyphenyl)methyl hydrogen sulfate |
| SMILES | CC(=O)O.COc1ccc(C=O)c(COS(=O)(=O)O)c1 |
| InChI | InChI=1S/C9H10O6S.C2H4O2/c1-14-9-3-2-7(5-10)8(4-9)6-15-16(11,12)13;1-2(3)4/h2-5H,6H2,1H3,(H,11,12,13);1H3,(H,3,4) |
| InChIKey | NUNASNGSYHQWOA-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|