C39H52N2 — CID 88530144
N-[(Z)-2-[5-(cyclohexen-1-yl)cyclohexa-1,3-dien-1-yl]-5-[4-[(Z)-1-iminopent-2-en-2-yl]-2,3,4,4a-tetrahydronaphthalen-1-yl]hex-2-enyl]cyclohex-2-en-1-amine (PubChem CID 88530144) has the molecular formula C39H52N2 and a molecular weight of 548.86 g/mol. Its IUPAC name is N-[(Z)-2-[5-(cyclohexen-1-yl)cyclohexa-1,3-dien-1-yl]-5-[4-[(Z)-1-iminopent-2-en-2-yl]-2,3,4,4a-tetrahydronaphthalen-1-yl]hex-2-enyl]cyclohex-2-en-1-amine.
| Compound Name | N-[(Z)-2-[5-(cyclohexen-1-yl)cyclohexa-1,3-dien-1-yl]-5-[4-[(Z)-1-iminopent-2-en-2-yl]-2,3,4,4a-tetrahydronaphthalen-1-yl]hex-2-enyl]cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 88530144 |
| Molecular Formula | C39H52N2 |
| Molecular Weight | 548.86 g/mol |
| Exact Mass | 548.41 |
| IUPAC Name | N-[(Z)-2-[5-(cyclohexen-1-yl)cyclohexa-1,3-dien-1-yl]-5-[4-[(Z)-1-iminopent-2-en-2-yl]-2,3,4,4a-tetrahydronaphthalen-1-yl]hex-2-enyl]cyclohex-2-en-1-amine |
| SMILES | [H]/N=C/C(=C\CC)C1CCC(C(C)C/C=C(\CNC2C=CCCC2)C2=CC=CC(C3=CCCCC3)C2)=C2C=CC=CC21 |
| InChI | InChI=1S/C39H52N2/c1-3-13-33(27-40)37-25-24-36(38-20-10-11-21-39(37)38)29(2)22-23-34(28-41-35-18-8-5-9-19-35)32-17-12-16-31(26-32)30-14-6-4-7-15-30/h8,10-14,16-18,20-21,23,27,29,31,35,37,39-41H,3-7,9,15,19,22,24-26,28H2,1-2H3/b33-13+,34-23+,40-27+ |
| InChIKey | AORKNFKDXZYRLQ-AETQDLDJSA-N |
| XLogP | 10.07 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.86 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|