C15H31NO6S3 — CID 88530556
3-[3-[3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]propyldisulfanyl]propoxy]-N-sulfanylpropanamide (PubChem CID 88530556) has the molecular formula C15H31NO6S3 and a molecular weight of 417.62 g/mol. Its IUPAC name is 3-[3-[3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]propyldisulfanyl]propoxy]-N-sulfanylpropanamide.
| Compound Name | 3-[3-[3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]propyldisulfanyl]propoxy]-N-sulfanylpropanamide |
|---|---|
| PubChem CID | 88530556 |
| Molecular Formula | C15H31NO6S3 |
| Molecular Weight | 417.62 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 3-[3-[3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]propyldisulfanyl]propoxy]-N-sulfanylpropanamide |
| SMILES | O=C(CCOCCCSSCCCOCCOCCOCCO)NS |
| InChI | InChI=1S/C15H31NO6S3/c17-4-8-21-10-12-22-11-9-20-6-2-14-25-24-13-1-5-19-7-3-15(18)16-23/h17,23H,1-14H2,(H,16,18) |
| InChIKey | FZFKSTAOBOICSW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.62 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|