About 3-(2-oxoethyl)hexyl propanoate
3-(2-oxoethyl)hexyl propanoate (PubChem CID 88531012) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is 3-(2-oxoethyl)hexyl propanoate.
Molecular Properties
| Compound Name | 3-(2-oxoethyl)hexyl propanoate |
| PubChem CID | 88531012 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 3-(2-oxoethyl)hexyl propanoate |
| SMILES | CCCC(CC=O)CCOC(=O)CC |
| InChI | InChI=1S/C11H20O3/c1-3-5-10(6-8-12)7-9-14-11(13)4-2/h8,10H,3-7,9H2,1-2H3 |
| InChIKey | IAUSMQWOLBAQBC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-oxoethyl)hexyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-oxoethyl)hexyl propanoate?
The IUPAC name of 3-(2-oxoethyl)hexyl propanoate (CID 88531012) is 3-(2-oxoethyl)hexyl propanoate.
What is the SMILES notation for 3-(2-oxoethyl)hexyl propanoate?
The canonical SMILES for 3-(2-oxoethyl)hexyl propanoate is CCCC(CC=O)CCOC(=O)CC.
What is the InChIKey of 3-(2-oxoethyl)hexyl propanoate?
The InChIKey is IAUSMQWOLBAQBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-3-5-10(6-8-12)7-9-14-11(13)4-2/h8,10H,3-7,9H2,1-2H3.
What are the key properties of 3-(2-oxoethyl)hexyl propanoate?
3-(2-oxoethyl)hexyl propanoate has a molecular weight of 200.28 g/mol, XLogP of 2.34, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-oxoethyl)hexyl propanoate is sourced from PubChem (CID 88531012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).