C17H29NO2Si — CID 88531877
2,4-ditert-butyl-6-trimethylsilyloxyiminocyclohexa-2,4-dien-1-one (PubChem CID 88531877) has the molecular formula C17H29NO2Si and a molecular weight of 307.51 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-trimethylsilyloxyiminocyclohexa-2,4-dien-1-one.
| Compound Name | 2,4-ditert-butyl-6-trimethylsilyloxyiminocyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 88531877 |
| Molecular Formula | C17H29NO2Si |
| Molecular Weight | 307.51 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 2,4-ditert-butyl-6-trimethylsilyloxyiminocyclohexa-2,4-dien-1-one |
| SMILES | CC(C)(C)C1=CC(=NO[Si](C)(C)C)C(=O)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C17H29NO2Si/c1-16(2,3)12-10-13(17(4,5)6)15(19)14(11-12)18-20-21(7,8)9/h10-11H,1-9H3 |
| InChIKey | FSBMFUGXXYEPCZ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|