C13H17NO3 — CID 10704909
3-tert-butyl-5-[(E)-N-methoxy-C-methylcarbonimidoyl]cyclohexa-3,5-diene-1,2-dione (PubChem CID 10704909) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 3-tert-butyl-5-[(E)-N-methoxy-C-methylcarbonimidoyl]cyclohexa-3,5-diene-1,2-dione.
| Compound Name | 3-tert-butyl-5-[(E)-N-methoxy-C-methylcarbonimidoyl]cyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 10704909 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 3-tert-butyl-5-[(E)-N-methoxy-C-methylcarbonimidoyl]cyclohexa-3,5-diene-1,2-dione |
| SMILES | CO/N=C(\C)C1=CC(=O)C(=O)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C13H17NO3/c1-8(14-17-5)9-6-10(13(2,3)4)12(16)11(15)7-9/h6-7H,1-5H3/b14-8+ |
| InChIKey | VPAIINYSGYTLJW-RIYZIHGNSA-N |
| XLogP | 2.06 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|