C15H23NO2 — CID 123547679
3,5-ditert-butyl-6-methoxyiminocyclohexa-2,4-dien-1-one (PubChem CID 123547679) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 3,5-ditert-butyl-6-methoxyiminocyclohexa-2,4-dien-1-one.
| Compound Name | 3,5-ditert-butyl-6-methoxyiminocyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 123547679 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 3,5-ditert-butyl-6-methoxyiminocyclohexa-2,4-dien-1-one |
| SMILES | CON=C1C(=O)C=C(C(C)(C)C)C=C1C(C)(C)C |
| InChI | InChI=1S/C15H23NO2/c1-14(2,3)10-8-11(15(4,5)6)13(16-18-7)12(17)9-10/h8-9H,1-7H3 |
| InChIKey | NYXVGVIXPAIZND-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|