C14H25NO2 — CID 100998587
(E,7Z)-7-hydroxyimino-2,2,5,8,8-pentamethylnon-5-en-3-one (PubChem CID 100998587) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is (E,7Z)-7-hydroxyimino-2,2,5,8,8-pentamethylnon-5-en-3-one.
| Compound Name | (E,7Z)-7-hydroxyimino-2,2,5,8,8-pentamethylnon-5-en-3-one |
|---|---|
| PubChem CID | 100998587 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | (E,7Z)-7-hydroxyimino-2,2,5,8,8-pentamethylnon-5-en-3-one |
| SMILES | C/C(=C\C(=N\O)C(C)(C)C)CC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H25NO2/c1-10(9-12(16)14(5,6)7)8-11(15-17)13(2,3)4/h8,17H,9H2,1-7H3/b10-8+,15-11- |
| InChIKey | MWOIOBQLPTTWTE-TYQAZIJWSA-N |
| XLogP | 3.81 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|