C11H19NO — CID 143460352
5-imino-3,3,7-trimethyloct-6-en-4-one (PubChem CID 143460352) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 5-imino-3,3,7-trimethyloct-6-en-4-one.
| Compound Name | 5-imino-3,3,7-trimethyloct-6-en-4-one |
|---|---|
| PubChem CID | 143460352 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 5-imino-3,3,7-trimethyloct-6-en-4-one |
| SMILES | [H]/N=C(\C=C(C)C)C(=O)C(C)(C)CC |
| InChI | InChI=1S/C11H19NO/c1-6-11(4,5)10(13)9(12)7-8(2)3/h7,12H,6H2,1-5H3/b12-9+ |
| InChIKey | RNASOOTYUHEIQG-FMIVXFBMSA-N |
| XLogP | 2.98 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|