C9H15NO — CID 123908856
4-imino-2,6-dimethylhept-5-en-3-one (PubChem CID 123908856) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 4-imino-2,6-dimethylhept-5-en-3-one.
| Compound Name | 4-imino-2,6-dimethylhept-5-en-3-one |
|---|---|
| PubChem CID | 123908856 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 4-imino-2,6-dimethylhept-5-en-3-one |
| SMILES | [H]/N=C(\C=C(C)C)C(=O)C(C)C |
| InChI | InChI=1S/C9H15NO/c1-6(2)5-8(10)9(11)7(3)4/h5,7,10H,1-4H3/b10-8+ |
| InChIKey | ZDMLSXBUEHXSCO-CSKARUKUSA-N |
| XLogP | 2.20 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|