C14H12N4 — CID 88532759
2-ethynyl-[1,2,4]triazolo[1,5-a]pyrimidine;toluene (PubChem CID 88532759) has the molecular formula C14H12N4 and a molecular weight of 236.28 g/mol. Its IUPAC name is 2-ethynyl-[1,2,4]triazolo[1,5-a]pyrimidine;toluene.
| Compound Name | 2-ethynyl-[1,2,4]triazolo[1,5-a]pyrimidine;toluene |
|---|---|
| PubChem CID | 88532759 |
| Molecular Formula | C14H12N4 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 2-ethynyl-[1,2,4]triazolo[1,5-a]pyrimidine;toluene |
| SMILES | C#Cc1nc2ncccn2n1.Cc1ccccc1 |
| InChI | InChI=1S/C7H4N4.C7H8/c1-2-6-9-7-8-4-3-5-11(7)10-6;1-7-5-3-2-4-6-7/h1,3-5H;2-6H,1H3 |
| InChIKey | RGAHKDSRIYCBNS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|