C17H25ClN2O3 — CID 88536204
1-[5-chloro-2-methoxy-4-methyl-3-(1-propan-2-ylazetidin-3-yl)phenyl]ethylcarbamic acid (PubChem CID 88536204) has the molecular formula C17H25ClN2O3 and a molecular weight of 340.85 g/mol. Its IUPAC name is 1-[5-chloro-2-methoxy-4-methyl-3-(1-propan-2-ylazetidin-3-yl)phenyl]ethylcarbamic acid.
| Compound Name | 1-[5-chloro-2-methoxy-4-methyl-3-(1-propan-2-ylazetidin-3-yl)phenyl]ethylcarbamic acid |
|---|---|
| PubChem CID | 88536204 |
| Molecular Formula | C17H25ClN2O3 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-[5-chloro-2-methoxy-4-methyl-3-(1-propan-2-ylazetidin-3-yl)phenyl]ethylcarbamic acid |
| SMILES | COc1c(C(C)NC(=O)O)cc(Cl)c(C)c1C1CN(C(C)C)C1 |
| InChI | InChI=1S/C17H25ClN2O3/c1-9(2)20-7-12(8-20)15-10(3)14(18)6-13(16(15)23-5)11(4)19-17(21)22/h6,9,11-12,19H,7-8H2,1-5H3,(H,21,22) |
| InChIKey | ACXYJMFLGLEIQK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |