C27H54N2O3Si — CID 88536969
2-trimethylsilylethyl 2-amino-6-[[(E)-hexadec-8-enoyl]amino]hexanoate (PubChem CID 88536969) has the molecular formula C27H54N2O3Si and a molecular weight of 482.83 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-amino-6-[[(E)-hexadec-8-enoyl]amino]hexanoate.
| Compound Name | 2-trimethylsilylethyl 2-amino-6-[[(E)-hexadec-8-enoyl]amino]hexanoate |
|---|---|
| PubChem CID | 88536969 |
| Molecular Formula | C27H54N2O3Si |
| Molecular Weight | 482.83 g/mol |
| Exact Mass | 482.39 |
| IUPAC Name | 2-trimethylsilylethyl 2-amino-6-[[(E)-hexadec-8-enoyl]amino]hexanoate |
| SMILES | CCCCCCC/C=C/CCCCCCC(=O)NCCCCC(N)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C27H54N2O3Si/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-21-26(30)29-22-19-18-20-25(28)27(31)32-23-24-33(2,3)4/h11-12,25H,5-10,13-24,28H2,1-4H3,(H,29,30)/b12-11+ |
| InChIKey | HCQFOJYVEJQGHR-VAWYXSNFSA-N |
| XLogP | 6.74 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.83 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|