C23H26BN5O2 — CID 88538500
CID 88538500 (PubChem CID 88538500) has the molecular formula C23H26BN5O2 and a molecular weight of 415.31 g/mol.
| Compound Name | CID 88538500 |
|---|---|
| PubChem CID | 88538500 |
| Molecular Formula | C23H26BN5O2 |
| Molecular Weight | 415.31 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)c(-c1cncc(O[C@H]3CNCCC34CC4)n1)nn2C1CCCCO1 |
| InChI | InChI=1S/C23H26BN5O2/c24-15-4-5-18-16(11-15)22(28-29(18)21-3-1-2-10-30-21)17-12-26-14-20(27-17)31-19-13-25-9-8-23(19)6-7-23/h4-5,11-12,14,19,21,25H,1-3,6-10,13H2/t19-,21?/m0/s1 |
| InChIKey | NXRLXMJLJANNND-ZQRQZVKFSA-N |
| XLogP | 2.51 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|