C10H6N4O2 — CID 88538737
2,3-dioxo-4a,5-dihydroquinoxaline-1,4-dicarbonitrile (PubChem CID 88538737) has the molecular formula C10H6N4O2 and a molecular weight of 214.18 g/mol. Its IUPAC name is 2,3-dioxo-4a,5-dihydroquinoxaline-1,4-dicarbonitrile.
| Compound Name | 2,3-dioxo-4a,5-dihydroquinoxaline-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 88538737 |
| Molecular Formula | C10H6N4O2 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 2,3-dioxo-4a,5-dihydroquinoxaline-1,4-dicarbonitrile |
| SMILES | N#CN1C(=O)C(=O)N(C#N)C2CC=CC=C21 |
| InChI | InChI=1S/C10H6N4O2/c11-5-13-7-3-1-2-4-8(7)14(6-12)10(16)9(13)15/h1-3,8H,4H2 |
| InChIKey | GHGYLQZEPZLWKK-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 88.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|