About (E)-3,3-dimethyl-N-(2-piperidin-1-ylethoxy)butan-2-imine
(E)-3,3-dimethyl-N-(2-piperidin-1-ylethoxy)butan-2-imine (PubChem CID 88538855) has the molecular formula C13H26N2O
and a molecular weight of 226.36 g/mol. Its IUPAC name is (E)-3,3-dimethyl-N-(2-piperidin-1-ylethoxy)butan-2-imine.
Molecular Properties
| Compound Name | (E)-3,3-dimethyl-N-(2-piperidin-1-ylethoxy)butan-2-imine |
| PubChem CID | 88538855 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | (E)-3,3-dimethyl-N-(2-piperidin-1-ylethoxy)butan-2-imine |
| SMILES | C/C(=N\OCCN1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C13H26N2O/c1-12(13(2,3)4)14-16-11-10-15-8-6-5-7-9-15/h5-11H2,1-4H3/b14-12+ |
| InChIKey | HSTFIFZKPVBIFR-WYMLVPIESA-N |
| XLogP | 2.91 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-3,3-dimethyl-N-(2-piperidin-1-ylethoxy)butan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3,3-dimethyl-N-(2-piperidin-1-ylethoxy)butan-2-imine?
The IUPAC name of (E)-3,3-dimethyl-N-(2-piperidin-1-ylethoxy)butan-2-imine (CID 88538855) is (E)-3,3-dimethyl-N-(2-piperidin-1-ylethoxy)butan-2-imine.
What is the SMILES notation for (E)-3,3-dimethyl-N-(2-piperidin-1-ylethoxy)butan-2-imine?
The canonical SMILES for (E)-3,3-dimethyl-N-(2-piperidin-1-ylethoxy)butan-2-imine is C/C(=N\OCCN1CCCCC1)C(C)(C)C.
What is the InChIKey of (E)-3,3-dimethyl-N-(2-piperidin-1-ylethoxy)butan-2-imine?
The InChIKey is HSTFIFZKPVBIFR-WYMLVPIESA-N. The full InChI is InChI=1S/C13H26N2O/c1-12(13(2,3)4)14-16-11-10-15-8-6-5-7-9-15/h5-11H2,1-4H3/b14-12+.
What are the key properties of (E)-3,3-dimethyl-N-(2-piperidin-1-ylethoxy)butan-2-imine?
(E)-3,3-dimethyl-N-(2-piperidin-1-ylethoxy)butan-2-imine has a molecular weight of 226.36 g/mol, XLogP of 2.91, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3,3-dimethyl-N-(2-piperidin-1-ylethoxy)butan-2-imine is sourced from PubChem (CID 88538855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).