C13H26N2O — CID 88538855
(E)-3,3-dimethyl-N-(2-piperidin-1-ylethoxy)butan-2-imine (PubChem CID 88538855) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is (E)-3,3-dimethyl-N-(2-piperidin-1-ylethoxy)butan-2-imine.
| Compound Name | (E)-3,3-dimethyl-N-(2-piperidin-1-ylethoxy)butan-2-imine |
|---|---|
| PubChem CID | 88538855 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | (E)-3,3-dimethyl-N-(2-piperidin-1-ylethoxy)butan-2-imine |
| SMILES | C/C(=N\OCCN1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C13H26N2O/c1-12(13(2,3)4)14-16-11-10-15-8-6-5-7-9-15/h5-11H2,1-4H3/b14-12+ |
| InChIKey | HSTFIFZKPVBIFR-WYMLVPIESA-N |
| XLogP | 2.91 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|