C20H32F8O3 — CID 88539341
3-(1,1-difluoro-2,2-dimethylpropyl)-4-(2,2-dimethylpropyl)-2,2,3-trifluoro-1-(2-methoxyethoxymethoxy)-1-(trifluoromethyl)cyclopentane (PubChem CID 88539341) has the molecular formula C20H32F8O3 and a molecular weight of 472.46 g/mol. Its IUPAC name is 3-(1,1-difluoro-2,2-dimethylpropyl)-4-(2,2-dimethylpropyl)-2,2,3-trifluoro-1-(2-methoxyethoxymethoxy)-1-(trifluoromethyl)cyclopentane.
| Compound Name | 3-(1,1-difluoro-2,2-dimethylpropyl)-4-(2,2-dimethylpropyl)-2,2,3-trifluoro-1-(2-methoxyethoxymethoxy)-1-(trifluoromethyl)cyclopentane |
|---|---|
| PubChem CID | 88539341 |
| Molecular Formula | C20H32F8O3 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 3-(1,1-difluoro-2,2-dimethylpropyl)-4-(2,2-dimethylpropyl)-2,2,3-trifluoro-1-(2-methoxyethoxymethoxy)-1-(trifluoromethyl)cyclopentane |
| SMILES | COCCOCOC1(C(F)(F)F)CC(CC(C)(C)C)C(F)(C(F)(F)C(C)(C)C)C1(F)F |
| InChI | InChI=1S/C20H32F8O3/c1-14(2,3)10-13-11-16(20(26,27)28,31-12-30-9-8-29-7)19(24,25)17(13,21)18(22,23)15(4,5)6/h13H,8-12H2,1-7H3 |
| InChIKey | JWBSIMUDPVEWHM-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|