C21H22ClNO2 — CID 88542691
methyl 4-[(5R,6S)-6-(6-chloro-3-pyridinyl)-5-methylhept-1-ynyl]benzoate (PubChem CID 88542691) has the molecular formula C21H22ClNO2 and a molecular weight of 355.87 g/mol. Its IUPAC name is methyl 4-[(5R,6S)-6-(6-chloro-3-pyridinyl)-5-methylhept-1-ynyl]benzoate.
| Compound Name | methyl 4-[(5R,6S)-6-(6-chloro-3-pyridinyl)-5-methylhept-1-ynyl]benzoate |
|---|---|
| PubChem CID | 88542691 |
| Molecular Formula | C21H22ClNO2 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | methyl 4-[(5R,6S)-6-(6-chloro-3-pyridinyl)-5-methylhept-1-ynyl]benzoate |
| SMILES | COC(=O)c1ccc(C#CCC[C@@H](C)[C@H](C)c2ccc(Cl)nc2)cc1 |
| InChI | InChI=1S/C21H22ClNO2/c1-15(16(2)19-12-13-20(22)23-14-19)6-4-5-7-17-8-10-18(11-9-17)21(24)25-3/h8-16H,4,6H2,1-3H3/t15-,16+/m1/s1 |
| InChIKey | APIOPYXJIRVGRP-CVEARBPZSA-N |
| XLogP | 5.09 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|