C20H15Br — CID 88544224
1-bromo-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]naphthalene (PubChem CID 88544224) has the molecular formula C20H15Br and a molecular weight of 335.24 g/mol. Its IUPAC name is 1-bromo-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]naphthalene.
| Compound Name | 1-bromo-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]naphthalene |
|---|---|
| PubChem CID | 88544224 |
| Molecular Formula | C20H15Br |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 1-bromo-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]naphthalene |
| SMILES | Brc1ccc(/C=C/C=C/c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C20H15Br/c21-20-15-14-17(18-12-6-7-13-19(18)20)11-5-4-10-16-8-2-1-3-9-16/h1-15H/b10-4+,11-5+ |
| InChIKey | LMYCUDVCZNASMT-ZVSIBQGLSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|