C20H14BrI — CID 122627652
1-bromo-4-[(1E,3E)-4-(4-iodophenyl)buta-1,3-dienyl]naphthalene (PubChem CID 122627652) has the molecular formula C20H14BrI and a molecular weight of 461.14 g/mol. Its IUPAC name is 1-bromo-4-[(1E,3E)-4-(4-iodophenyl)buta-1,3-dienyl]naphthalene.
| Compound Name | 1-bromo-4-[(1E,3E)-4-(4-iodophenyl)buta-1,3-dienyl]naphthalene |
|---|---|
| PubChem CID | 122627652 |
| Molecular Formula | C20H14BrI |
| Molecular Weight | 461.14 g/mol |
| Exact Mass | 459.93 |
| IUPAC Name | 1-bromo-4-[(1E,3E)-4-(4-iodophenyl)buta-1,3-dienyl]naphthalene |
| SMILES | Brc1ccc(/C=C/C=C/c2ccc(I)cc2)c2ccccc12 |
| InChI | InChI=1S/C20H14BrI/c21-20-14-11-16(18-7-3-4-8-19(18)20)6-2-1-5-15-9-12-17(22)13-10-15/h1-14H/b5-1+,6-2+ |
| InChIKey | CXUXJPNZEWQFKP-IJIVKGSJSA-N |
| XLogP | 6.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.14 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|