C16H17N5OS2 — CID 88544324
1-[6-(2-acetyl-2,3-dihydrothiophen-5-yl)pyrido[2,3-b]pyrazin-3-yl]-3-ethylthiourea (PubChem CID 88544324) has the molecular formula C16H17N5OS2 and a molecular weight of 359.48 g/mol. Its IUPAC name is 1-[6-(2-acetyl-2,3-dihydrothiophen-5-yl)pyrido[2,3-b]pyrazin-3-yl]-3-ethylthiourea.
| Compound Name | 1-[6-(2-acetyl-2,3-dihydrothiophen-5-yl)pyrido[2,3-b]pyrazin-3-yl]-3-ethylthiourea |
|---|---|
| PubChem CID | 88544324 |
| Molecular Formula | C16H17N5OS2 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 1-[6-(2-acetyl-2,3-dihydrothiophen-5-yl)pyrido[2,3-b]pyrazin-3-yl]-3-ethylthiourea |
| SMILES | CCNC(=S)Nc1cnc2ccc(C3=CCC(C(C)=O)S3)nc2n1 |
| InChI | InChI=1S/C16H17N5OS2/c1-3-17-16(23)21-14-8-18-11-5-4-10(19-15(11)20-14)13-7-6-12(24-13)9(2)22/h4-5,7-8,12H,3,6H2,1-2H3,(H2,17,19,20,21,23) |
| InChIKey | WFIUWQDSSYZILY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|