About pentacene-2,6-dicarboxylic acid
pentacene-2,6-dicarboxylic acid (PubChem CID 88551135) has the molecular formula C24H14O4
and a molecular weight of 366.37 g/mol. Its IUPAC name is pentacene-2,6-dicarboxylic acid.
Molecular Properties
| Compound Name | pentacene-2,6-dicarboxylic acid |
| PubChem CID | 88551135 |
| Molecular Formula | C24H14O4 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | pentacene-2,6-dicarboxylic acid |
| SMILES | O=C(O)c1ccc2cc3c(C(=O)O)c4cc5ccccc5cc4cc3cc2c1 |
| InChI | InChI=1S/C24H14O4/c25-23(26)16-6-5-15-12-21-19(9-17(15)8-16)10-18-7-13-3-1-2-4-14(13)11-20(18)22(21)24(27)28/h1-12H,(H,25,26)(H,27,28) |
| InChIKey | WSDRKOIWBBJGGI-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze pentacene-2,6-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentacene-2,6-dicarboxylic acid?
The IUPAC name of pentacene-2,6-dicarboxylic acid (CID 88551135) is pentacene-2,6-dicarboxylic acid.
What is the SMILES notation for pentacene-2,6-dicarboxylic acid?
The canonical SMILES for pentacene-2,6-dicarboxylic acid is O=C(O)c1ccc2cc3c(C(=O)O)c4cc5ccccc5cc4cc3cc2c1.
What is the InChIKey of pentacene-2,6-dicarboxylic acid?
The InChIKey is WSDRKOIWBBJGGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H14O4/c25-23(26)16-6-5-15-12-21-19(9-17(15)8-16)10-18-7-13-3-1-2-4-14(13)11-20(18)22(21)24(27)28/h1-12H,(H,25,26)(H,27,28).
What are the key properties of pentacene-2,6-dicarboxylic acid?
pentacene-2,6-dicarboxylic acid has a molecular weight of 366.37 g/mol, XLogP of 5.70, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentacene-2,6-dicarboxylic acid is sourced from PubChem (CID 88551135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).