C23H42O7 — CID 88553170
7-methoxy-7-methyl-6-oxo-3-[2-(6-pentan-3-yloxyhexanoyloxy)ethyl]octanoic acid (PubChem CID 88553170) has the molecular formula C23H42O7 and a molecular weight of 430.58 g/mol. Its IUPAC name is 7-methoxy-7-methyl-6-oxo-3-[2-(6-pentan-3-yloxyhexanoyloxy)ethyl]octanoic acid.
| Compound Name | 7-methoxy-7-methyl-6-oxo-3-[2-(6-pentan-3-yloxyhexanoyloxy)ethyl]octanoic acid |
|---|---|
| PubChem CID | 88553170 |
| Molecular Formula | C23H42O7 |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | 7-methoxy-7-methyl-6-oxo-3-[2-(6-pentan-3-yloxyhexanoyloxy)ethyl]octanoic acid |
| SMILES | CCC(CC)OCCCCCC(=O)OCCC(CCC(=O)C(C)(C)OC)CC(=O)O |
| InChI | InChI=1S/C23H42O7/c1-6-19(7-2)29-15-10-8-9-11-22(27)30-16-14-18(17-21(25)26)12-13-20(24)23(3,4)28-5/h18-19H,6-17H2,1-5H3,(H,25,26) |
| InChIKey | UFJYPAMSTBXPKE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|