C16H32O6 — CID 158303130
deuterium monohydride;methane;4-[2-(5-methoxypentanoyloxy)ethyl]-6-oxoheptanoic acid (PubChem CID 158303130) has the molecular formula C16H32O6 and a molecular weight of 321.43 g/mol. Its IUPAC name is deuterium monohydride;methane;4-[2-(5-methoxypentanoyloxy)ethyl]-6-oxoheptanoic acid.
| Compound Name | deuterium monohydride;methane;4-[2-(5-methoxypentanoyloxy)ethyl]-6-oxoheptanoic acid |
|---|---|
| PubChem CID | 158303130 |
| Molecular Formula | C16H32O6 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | deuterium monohydride;methane;4-[2-(5-methoxypentanoyloxy)ethyl]-6-oxoheptanoic acid |
| SMILES | C.COCCCCC(=O)OCCC(CCC(=O)O)CC(C)=O.[H][2H] |
| InChI | InChI=1S/C15H26O6.CH4.H2/c1-12(16)11-13(6-7-14(17)18)8-10-21-15(19)5-3-4-9-20-2;;/h13H,3-11H2,1-2H3,(H,17,18);1H4;1H/i;;1+1 |
| InChIKey | GMSWMWQNNDXWGE-FCHARDOESA-N |
| XLogP | 3.08 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|