C18H26O14 — CID 88553476
dimethyl 2,3-bis[(1,4-dimethoxy-1,4-dioxobutan-2-yl)oxy]butanedioate (PubChem CID 88553476) has the molecular formula C18H26O14 and a molecular weight of 466.39 g/mol. Its IUPAC name is dimethyl 2,3-bis[(1,4-dimethoxy-1,4-dioxobutan-2-yl)oxy]butanedioate.
| Compound Name | dimethyl 2,3-bis[(1,4-dimethoxy-1,4-dioxobutan-2-yl)oxy]butanedioate |
|---|---|
| PubChem CID | 88553476 |
| Molecular Formula | C18H26O14 |
| Molecular Weight | 466.39 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | dimethyl 2,3-bis[(1,4-dimethoxy-1,4-dioxobutan-2-yl)oxy]butanedioate |
| SMILES | COC(=O)CC(OC(C(=O)OC)C(OC(CC(=O)OC)C(=O)OC)C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C18H26O14/c1-25-11(19)7-9(15(21)27-3)31-13(17(23)29-5)14(18(24)30-6)32-10(16(22)28-4)8-12(20)26-2/h9-10,13-14H,7-8H2,1-6H3 |
| InChIKey | UWNGZKVFBSWGSG-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 176.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.39 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|