C15H22N2O5 — CID 88554292
(3S)-3-[2-hydroperoxy-2-(2-nitrophenyl)ethyl]-5-methylhexanamide (PubChem CID 88554292) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is (3S)-3-[2-hydroperoxy-2-(2-nitrophenyl)ethyl]-5-methylhexanamide.
| Compound Name | (3S)-3-[2-hydroperoxy-2-(2-nitrophenyl)ethyl]-5-methylhexanamide |
|---|---|
| PubChem CID | 88554292 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | (3S)-3-[2-hydroperoxy-2-(2-nitrophenyl)ethyl]-5-methylhexanamide |
| SMILES | CC(C)C[C@H](CC(N)=O)CC(OO)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H22N2O5/c1-10(2)7-11(9-15(16)18)8-14(22-21)12-5-3-4-6-13(12)17(19)20/h3-6,10-11,14,21H,7-9H2,1-2H3,(H2,16,18)/t11-,14?/m0/s1 |
| InChIKey | ZXYRLZJVGVHCDY-ZSOXZCCMSA-N |
| XLogP | 3.05 |
| TPSA | 115.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|