C20H20N3O3+ — CID 8855474
(2R)-N-(1,3-benzodioxol-5-ylmethyl)-2-(3-ethenylbenzimidazol-1-ium-1-yl)propanamide (PubChem CID 8855474) has the molecular formula C20H20N3O3+ and a molecular weight of 350.40 g/mol. Its IUPAC name is (2R)-N-(1,3-benzodioxol-5-ylmethyl)-2-(3-ethenylbenzimidazol-1-ium-1-yl)propanamide.
| Compound Name | (2R)-N-(1,3-benzodioxol-5-ylmethyl)-2-(3-ethenylbenzimidazol-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 8855474 |
| Molecular Formula | C20H20N3O3+ |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (2R)-N-(1,3-benzodioxol-5-ylmethyl)-2-(3-ethenylbenzimidazol-1-ium-1-yl)propanamide |
| SMILES | C=Cn1c[n+]([C@H](C)C(=O)NCc2ccc3c(c2)OCO3)c2ccccc21 |
| InChI | InChI=1S/C20H19N3O3/c1-3-22-12-23(17-7-5-4-6-16(17)22)14(2)20(24)21-11-15-8-9-18-19(10-15)26-13-25-18/h3-10,12,14H,1,11,13H2,2H3/p+1/t14-/m1/s1 |
| InChIKey | CIDFHZIOYWIQAL-CQSZACIVSA-O |
| XLogP | 2.64 |
| TPSA | 56.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|