About CID 88556046
CID 88556046 (PubChem CID 88556046) has the molecular formula C8H10BN
and a molecular weight of 130.99 g/mol.
Molecular Properties
| Compound Name | CID 88556046 |
| PubChem CID | 88556046 |
| Molecular Formula | C8H10BN |
| Molecular Weight | 130.99 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | — |
| SMILES | [B]c1cccc(C(C)N)c1 |
| InChI | InChI=1S/C8H10BN/c1-6(10)7-3-2-4-8(9)5-7/h2-6H,10H2,1H3 |
| InChIKey | WTMUIIXKIQBGRR-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.99 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 88556046 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88556046?
The IUPAC name of CID 88556046 (CID 88556046) is not available.
What is the SMILES notation for CID 88556046?
The canonical SMILES for CID 88556046 is [B]c1cccc(C(C)N)c1.
What is the InChIKey of CID 88556046?
The InChIKey is WTMUIIXKIQBGRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BN/c1-6(10)7-3-2-4-8(9)5-7/h2-6H,10H2,1H3.
What are the key properties of CID 88556046?
CID 88556046 has a molecular weight of 130.99 g/mol, XLogP of 0.50, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88556046 is sourced from PubChem (CID 88556046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).