About 3-tert-butyl-5,5-dimethylhexanenitrile
3-tert-butyl-5,5-dimethylhexanenitrile (PubChem CID 88560421) has the molecular formula C12H23N
and a molecular weight of 181.32 g/mol. Its IUPAC name is 3-tert-butyl-5,5-dimethylhexanenitrile.
Molecular Properties
| Compound Name | 3-tert-butyl-5,5-dimethylhexanenitrile |
| PubChem CID | 88560421 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 3-tert-butyl-5,5-dimethylhexanenitrile |
| SMILES | CC(C)(C)CC(CC#N)C(C)(C)C |
| InChI | InChI=1S/C12H23N/c1-11(2,3)9-10(7-8-13)12(4,5)6/h10H,7,9H2,1-6H3 |
| InChIKey | XIKVXPHYEXJHLZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-tert-butyl-5,5-dimethylhexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-5,5-dimethylhexanenitrile?
The IUPAC name of 3-tert-butyl-5,5-dimethylhexanenitrile (CID 88560421) is 3-tert-butyl-5,5-dimethylhexanenitrile.
What is the SMILES notation for 3-tert-butyl-5,5-dimethylhexanenitrile?
The canonical SMILES for 3-tert-butyl-5,5-dimethylhexanenitrile is CC(C)(C)CC(CC#N)C(C)(C)C.
What is the InChIKey of 3-tert-butyl-5,5-dimethylhexanenitrile?
The InChIKey is XIKVXPHYEXJHLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N/c1-11(2,3)9-10(7-8-13)12(4,5)6/h10H,7,9H2,1-6H3.
What are the key properties of 3-tert-butyl-5,5-dimethylhexanenitrile?
3-tert-butyl-5,5-dimethylhexanenitrile has a molecular weight of 181.32 g/mol, XLogP of 4.00, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-5,5-dimethylhexanenitrile is sourced from PubChem (CID 88560421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).