C22H15N3O11 — CID 88561123
[(2R,3R)-7-hydroxy-2-(3-hydroxy-4,5-dinitrosophenyl)-5-nitroso-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate (PubChem CID 88561123) has the molecular formula C22H15N3O11 and a molecular weight of 497.37 g/mol. Its IUPAC name is [(2R,3R)-7-hydroxy-2-(3-hydroxy-4,5-dinitrosophenyl)-5-nitroso-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate.
| Compound Name | [(2R,3R)-7-hydroxy-2-(3-hydroxy-4,5-dinitrosophenyl)-5-nitroso-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 88561123 |
| Molecular Formula | C22H15N3O11 |
| Molecular Weight | 497.37 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | [(2R,3R)-7-hydroxy-2-(3-hydroxy-4,5-dinitrosophenyl)-5-nitroso-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
| SMILES | O=Nc1cc(O)cc2c1C[C@@H](OC(=O)c1cc(O)c(O)c(O)c1)[C@@H](c1cc(O)c(N=O)c(N=O)c1)O2 |
| InChI | InChI=1S/C22H15N3O11/c26-10-5-12(23-32)11-7-18(36-22(31)9-3-15(28)20(30)16(29)4-9)21(35-17(11)6-10)8-1-13(24-33)19(25-34)14(27)2-8/h1-6,18,21,26-30H,7H2/t18-,21-/m1/s1 |
| InChIKey | BIYIKKQIGKRZKA-WIYYLYMNSA-N |
| XLogP | 4.31 |
| TPSA | 224.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|