About [(3Z)-5-methylhepta-1,3-dien-2-yl]hydrazine
[(3Z)-5-methylhepta-1,3-dien-2-yl]hydrazine (PubChem CID 88561370) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is [(3Z)-5-methylhepta-1,3-dien-2-yl]hydrazine.
Molecular Properties
| Compound Name | [(3Z)-5-methylhepta-1,3-dien-2-yl]hydrazine |
| PubChem CID | 88561370 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | [(3Z)-5-methylhepta-1,3-dien-2-yl]hydrazine |
| SMILES | C=C(/C=C\C(C)CC)NN |
| InChI | InChI=1S/C8H16N2/c1-4-7(2)5-6-8(3)10-9/h5-7,10H,3-4,9H2,1-2H3/b6-5- |
| InChIKey | BHGYEQOKPLAETD-WAYWQWQTSA-N |
| XLogP | 1.57 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3Z)-5-methylhepta-1,3-dien-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z)-5-methylhepta-1,3-dien-2-yl]hydrazine?
The IUPAC name of [(3Z)-5-methylhepta-1,3-dien-2-yl]hydrazine (CID 88561370) is [(3Z)-5-methylhepta-1,3-dien-2-yl]hydrazine.
What is the SMILES notation for [(3Z)-5-methylhepta-1,3-dien-2-yl]hydrazine?
The canonical SMILES for [(3Z)-5-methylhepta-1,3-dien-2-yl]hydrazine is C=C(/C=C\C(C)CC)NN.
What is the InChIKey of [(3Z)-5-methylhepta-1,3-dien-2-yl]hydrazine?
The InChIKey is BHGYEQOKPLAETD-WAYWQWQTSA-N. The full InChI is InChI=1S/C8H16N2/c1-4-7(2)5-6-8(3)10-9/h5-7,10H,3-4,9H2,1-2H3/b6-5-.
What are the key properties of [(3Z)-5-methylhepta-1,3-dien-2-yl]hydrazine?
[(3Z)-5-methylhepta-1,3-dien-2-yl]hydrazine has a molecular weight of 140.23 g/mol, XLogP of 1.57, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z)-5-methylhepta-1,3-dien-2-yl]hydrazine is sourced from PubChem (CID 88561370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).