C8H16N2 — CID 88561370
[(3Z)-5-methylhepta-1,3-dien-2-yl]hydrazine (PubChem CID 88561370) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is [(3Z)-5-methylhepta-1,3-dien-2-yl]hydrazine.
| Compound Name | [(3Z)-5-methylhepta-1,3-dien-2-yl]hydrazine |
|---|---|
| PubChem CID | 88561370 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | [(3Z)-5-methylhepta-1,3-dien-2-yl]hydrazine |
| SMILES | C=C(/C=C\C(C)CC)NN |
| InChI | InChI=1S/C8H16N2/c1-4-7(2)5-6-8(3)10-9/h5-7,10H,3-4,9H2,1-2H3/b6-5- |
| InChIKey | BHGYEQOKPLAETD-WAYWQWQTSA-N |
| XLogP | 1.57 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|