C68H46N8O6 — CID 88562688
4-[15-(4-cyanophenyl)-10,20-bis[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]-21,23-dihydroporphyrin-5-yl]benzonitrile (PubChem CID 88562688) has the molecular formula C68H46N8O6 and a molecular weight of 1071.17 g/mol. Its IUPAC name is 4-[15-(4-cyanophenyl)-10,20-bis[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]-21,23-dihydroporphyrin-5-yl]benzonitrile.
| Compound Name | 4-[15-(4-cyanophenyl)-10,20-bis[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]-21,23-dihydroporphyrin-5-yl]benzonitrile |
|---|---|
| PubChem CID | 88562688 |
| Molecular Formula | C68H46N8O6 |
| Molecular Weight | 1071.17 g/mol |
| Exact Mass | 1070.35 |
| IUPAC Name | 4-[15-(4-cyanophenyl)-10,20-bis[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]-21,23-dihydroporphyrin-5-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2c3nc(c(-c4ccc(OCCCN5C(=O)c6ccccc6C5=O)cc4)c4ccc([nH]4)c(-c4ccc(C#N)cc4)c4nc(c(-c5ccc(OCCCN6C(=O)c7ccccc7C6=O)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C68H46N8O6/c69-39-41-11-15-43(16-12-41)61-53-27-31-57(71-53)63(45-19-23-47(24-20-45)81-37-5-35-75-65(77)49-7-1-2-8-50(49)66(75)78)58-32-28-54(72-58)62(44-17-13-42(40-70)14-18-44)56-30-34-60(74-56)64(59-33-29-55(61)73-59)46-21-25-48(26-22-46)82-38-6-36-76-67(79)51-9-3-4-10-52(51)68(76)80/h1-4,7-34,71,74H,5-6,35-38H2/b61-53-,61-55-,62-54-,62-56-,63-57-,63-58-,64-59-,64-60- |
| InChIKey | SETZFSFXTFRLLL-JBELVHSVSA-N |
| XLogP | 13.20 |
| TPSA | 198.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1071.17 |
| LogP ≤ 5 | 13.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|