C56H28F15N5O2 — CID 137252079
[4-[10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]phenyl] 4-(1-methylpyrrolidin-2-yl)benzoate (PubChem CID 137252079) has the molecular formula C56H28F15N5O2 and a molecular weight of 1087.84 g/mol. Its IUPAC name is [4-[10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]phenyl] 4-(1-methylpyrrolidin-2-yl)benzoate.
| Compound Name | [4-[10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]phenyl] 4-(1-methylpyrrolidin-2-yl)benzoate |
|---|---|
| PubChem CID | 137252079 |
| Molecular Formula | C56H28F15N5O2 |
| Molecular Weight | 1087.84 g/mol |
| Exact Mass | 1087.20 |
| IUPAC Name | [4-[10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]phenyl] 4-(1-methylpyrrolidin-2-yl)benzoate |
| SMILES | CN1CCCC1c1ccc(C(=O)Oc2ccc(-c3c4nc(c(-c5c(F)c(F)c(F)c(F)c5F)c5ccc([nH]5)c(-c5c(F)c(F)c(F)c(F)c5F)c5nc(c(-c6c(F)c(F)c(F)c(F)c6F)c6ccc3[nH]6)C=C5)C=C4)cc2)cc1 |
| InChI | InChI=1S/C56H28F15N5O2/c1-76-20-2-3-33(76)21-4-6-23(7-5-21)56(77)78-24-10-8-22(9-11-24)34-25-12-14-27(72-25)35(38-41(57)47(63)53(69)48(64)42(38)58)29-16-18-31(74-29)37(40-45(61)51(67)55(71)52(68)46(40)62)32-19-17-30(75-32)36(28-15-13-26(34)73-28)39-43(59)49(65)54(70)50(66)44(39)60/h4-19,33,72,75H,2-3,20H2,1H3/b34-25-,34-26-,35-27+,35-29+,36-28+,36-30+,37-31+,37-32+ |
| InChIKey | MFWVMNYFKJOROR-KHYOPNBCSA-N |
| XLogP | 15.40 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1087.84 |
| LogP ≤ 5 | 15.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|