C50H29F5N4O — CID 135524771
5-[4-(2,3,4,5,6-pentafluorophenoxy)phenyl]-10,15,20-triphenyl-21,23-dihydroporphyrin (PubChem CID 135524771) has the molecular formula C50H29F5N4O and a molecular weight of 796.80 g/mol. Its IUPAC name is 5-[4-(2,3,4,5,6-pentafluorophenoxy)phenyl]-10,15,20-triphenyl-21,23-dihydroporphyrin.
| Compound Name | 5-[4-(2,3,4,5,6-pentafluorophenoxy)phenyl]-10,15,20-triphenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135524771 |
| Molecular Formula | C50H29F5N4O |
| Molecular Weight | 796.80 g/mol |
| Exact Mass | 796.23 |
| IUPAC Name | 5-[4-(2,3,4,5,6-pentafluorophenoxy)phenyl]-10,15,20-triphenyl-21,23-dihydroporphyrin |
| SMILES | Fc1c(F)c(F)c(Oc2ccc(-c3c4nc(c(-c5ccccc5)c5ccc([nH]5)c(-c5ccccc5)c5nc(c(-c6ccccc6)c6ccc3[nH]6)C=C5)C=C4)cc2)c(F)c1F |
| InChI | InChI=1S/C50H29F5N4O/c51-45-46(52)48(54)50(49(55)47(45)53)60-32-18-16-31(17-19-32)44-39-26-24-37(58-39)42(29-12-6-2-7-13-29)35-22-20-33(56-35)41(28-10-4-1-5-11-28)34-21-23-36(57-34)43(30-14-8-3-9-15-30)38-25-27-40(44)59-38/h1-27,56,59H/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40- |
| InChIKey | DLCMIMMYFPXMDQ-LWQDQPMZSA-N |
| XLogP | 13.81 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.80 |
| LogP ≤ 5 | 13.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|