C72H46N4O8 — CID 100941712
[4-[10,15,20-tris(4-benzoyloxyphenyl)-21,23-dihydroporphyrin-5-yl]phenyl] benzoate (PubChem CID 100941712) has the molecular formula C72H46N4O8 and a molecular weight of 1095.18 g/mol. Its IUPAC name is [4-[10,15,20-tris(4-benzoyloxyphenyl)-21,23-dihydroporphyrin-5-yl]phenyl] benzoate.
| Compound Name | [4-[10,15,20-tris(4-benzoyloxyphenyl)-21,23-dihydroporphyrin-5-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 100941712 |
| Molecular Formula | C72H46N4O8 |
| Molecular Weight | 1095.18 g/mol |
| Exact Mass | 1094.33 |
| IUPAC Name | [4-[10,15,20-tris(4-benzoyloxyphenyl)-21,23-dihydroporphyrin-5-yl]phenyl] benzoate |
| SMILES | O=C(Oc1ccc(-c2c3nc(c(-c4ccc(OC(=O)c5ccccc5)cc4)c4ccc([nH]4)c(-c4ccc(OC(=O)c5ccccc5)cc4)c4nc(c(-c5ccc(OC(=O)c6ccccc6)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1)c1ccccc1 |
| InChI | InChI=1S/C72H46N4O8/c77-69(49-13-5-1-6-14-49)81-53-29-21-45(22-30-53)65-57-37-39-59(73-57)66(46-23-31-54(32-24-46)82-70(78)50-15-7-2-8-16-50)61-41-43-63(75-61)68(48-27-35-56(36-28-48)84-72(80)52-19-11-4-12-20-52)64-44-42-62(76-64)67(60-40-38-58(65)74-60)47-25-33-55(34-26-47)83-71(79)51-17-9-3-10-18-51/h1-44,73,76H/b65-57-,65-58-,66-59-,66-61-,67-60-,67-62-,68-63-,68-64- |
| InChIKey | IGTUOJMLKGBLDF-ZOUHOBQGSA-N |
| XLogP | 16.20 |
| TPSA | 162.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1095.18 |
| LogP ≤ 5 | 16.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|