C14H26O — CID 88563765
3-(4-methylpenta-1,4-dien-2-yloxymethyl)heptane (PubChem CID 88563765) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is 3-(4-methylpenta-1,4-dien-2-yloxymethyl)heptane.
| Compound Name | 3-(4-methylpenta-1,4-dien-2-yloxymethyl)heptane |
|---|---|
| PubChem CID | 88563765 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 3-(4-methylpenta-1,4-dien-2-yloxymethyl)heptane |
| SMILES | C=C(C)CC(=C)OCC(CC)CCCC |
| InChI | InChI=1S/C14H26O/c1-6-8-9-14(7-2)11-15-13(5)10-12(3)4/h14H,3,5-11H2,1-2,4H3 |
| InChIKey | BWWMLBFSWXUYBS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|