C18H15N5O2S — CID 88563807
6-(5,6-dimethoxy-3-pyridinyl)-N-pyrazin-2-yl-1,3-benzothiazol-2-amine (PubChem CID 88563807) has the molecular formula C18H15N5O2S and a molecular weight of 365.42 g/mol. Its IUPAC name is 6-(5,6-dimethoxy-3-pyridinyl)-N-pyrazin-2-yl-1,3-benzothiazol-2-amine.
| Compound Name | 6-(5,6-dimethoxy-3-pyridinyl)-N-pyrazin-2-yl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 88563807 |
| Molecular Formula | C18H15N5O2S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 6-(5,6-dimethoxy-3-pyridinyl)-N-pyrazin-2-yl-1,3-benzothiazol-2-amine |
| SMILES | COc1cc(-c2ccc3nc(Nc4cnccn4)sc3c2)cnc1OC |
| InChI | InChI=1S/C18H15N5O2S/c1-24-14-7-12(9-21-17(14)25-2)11-3-4-13-15(8-11)26-18(22-13)23-16-10-19-5-6-20-16/h3-10H,1-2H3,(H,20,22,23) |
| InChIKey | MQPRJHZQGXOLDA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |