C15H12N4O2S2 — CID 88568521
N-(4-methylphenyl)sulfanyl-3-(3-nitrophenyl)-1,2,4-thiadiazol-5-amine (PubChem CID 88568521) has the molecular formula C15H12N4O2S2 and a molecular weight of 344.42 g/mol. Its IUPAC name is N-(4-methylphenyl)sulfanyl-3-(3-nitrophenyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(4-methylphenyl)sulfanyl-3-(3-nitrophenyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 88568521 |
| Molecular Formula | C15H12N4O2S2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | N-(4-methylphenyl)sulfanyl-3-(3-nitrophenyl)-1,2,4-thiadiazol-5-amine |
| SMILES | Cc1ccc(SNc2nc(-c3cccc([N+](=O)[O-])c3)ns2)cc1 |
| InChI | InChI=1S/C15H12N4O2S2/c1-10-5-7-13(8-6-10)22-18-15-16-14(17-23-15)11-3-2-4-12(9-11)19(20)21/h2-9H,1H3,(H,16,17,18) |
| InChIKey | MOIJZVYJYDKTCQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|