C14H15F6N3O2 — CID 88569176
N-[1-[2-(2,3-dihydro-1,4-benzodioxin-5-yl)hydrazinyl]ethenyl]-1,1,1,3,3,3-hexafluoro-2-methylpropan-2-amine (PubChem CID 88569176) has the molecular formula C14H15F6N3O2 and a molecular weight of 371.28 g/mol. Its IUPAC name is N-[1-[2-(2,3-dihydro-1,4-benzodioxin-5-yl)hydrazinyl]ethenyl]-1,1,1,3,3,3-hexafluoro-2-methylpropan-2-amine.
| Compound Name | N-[1-[2-(2,3-dihydro-1,4-benzodioxin-5-yl)hydrazinyl]ethenyl]-1,1,1,3,3,3-hexafluoro-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 88569176 |
| Molecular Formula | C14H15F6N3O2 |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | N-[1-[2-(2,3-dihydro-1,4-benzodioxin-5-yl)hydrazinyl]ethenyl]-1,1,1,3,3,3-hexafluoro-2-methylpropan-2-amine |
| SMILES | C=C(NNc1cccc2c1OCCO2)NC(C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H15F6N3O2/c1-8(21-12(2,13(15,16)17)14(18,19)20)22-23-9-4-3-5-10-11(9)25-7-6-24-10/h3-5,21-23H,1,6-7H2,2H3 |
| InChIKey | OUABXDKGOBCGPD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 54.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|